12-06-2021
History

contestada

when did the otoman empire rise and when did it fall

Respuesta :

cdusgsgsgushdvh cdusgsgsgushdvh

12-06-2021

The foundation and rise of the Ottoman Empire is a period of history that started with the emergence of the Ottoman principality (Osmanlı Beyliği) in c. 1299, and ended circa 1453.

Answer Link

Otras preguntas

What substitution should be used to rewrite 6(x 5)2 5(x 5) – 4 = 0 as a quadratic equation?

What is the distance between the points (4, 5) and (10, 13) on a coordinate plane?

Part E Tsunami evacuation plans often consider the elevation of the community and its distance from the shoreline when deciding which towns to evacuate. How cou

Former U.S. President Richard Nixon resigned from office before he faced impeachment charges for his role in the Watergate scandal, which involved a break-in an

what is -36 degrees converted to radians

What is the main purpose of this map? 1: economic activity 2: Population density 3: political features 4: physical features

Which statement best describes a cause of World War I?

Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please

Drag each tutorial feature to its learning purpose.

A baseball "diamond" is actually a square with side lengths of 90 feet. In a game, a runner tries to steal second base. How far must the catcher throw from home