Hufflaker Hufflaker

15-08-2020
Mathematics

contestada

Value of sin^6 + cos^6+3sin^2cos^2

Value of sin6 cos63sin2cos2 class=

Respuesta :

Aeteriss Aeteriss

15-08-2020

Step-by-step explanation:

If you put into a calculator "Sin(6)+Cos(6)+3Sin(2)Cos(2)", you get 1.20368506925. Hope that helps

Answer Link

Otras preguntas

How does the changing description of the wallpaper reflect the narrator's changing character?

Match each drug to its description. Potential Matches: 1 : Toxic chemicals in household products 2 : Hemp; active ingredient THC 3 : Speeds up the body's func

raisa recevice a 9% commission on all items that she sales. her commision for her sales last week was 121.50. what was the dollar value of her sale last week.

What's the correct answer?

(Please answer quickly) Philip has between two hundred and three hundred baseball cards. which inequality represents thus situation?F.) 200 < p < 300G.) p

tia is planning a sailing party for her friends the boat rental is 15$ plus an additional 15$ per person tia has saved up 400$ what is the maximum number of peo

Select the equation of the line that passes through the point (3, 5) and is perpendicular to the line x = 4. y = 5 x = 5 y = 4 x = 3

Describe Ernest Rutherford's experiment with gold foil and alpha particles. Explain how this experiment helped us understand the nature of atoms.

How did new industries change the lives of Americans in the 1920s

The Amazon River can be found in: North America Europe Africa South America Asia