margodavies53022 margodavies53022

12-11-2022
Biology

contestada

Is O2 (oxygen gas) a molecule
Is H2O (water) a molecule
Is N2 (nitrogen gas) a molecule
Is CO2 (carbon dioxide gas) a molecule
Is CH4 (methane gas) a molecule
this is 5th grade science btw!

Respuesta :

Otras preguntas

What is the prime factorization of 39

Ellie is placing an order for 5 tuna salads and 2 chicken salads. Each salad costs $8.50 , including tax. What is the total cost of the salads?the answer is 5

Find two numbers A and B (with AB) whose difference is 44 and whose product is minimized.

Why were'nt Spartans allowed to trade or travel

Which is the value of 3b2−b when b = 5? Im so confused

1. Which ordered pair is a solution of the equation shown? (−2, 0) (1, 3) (−1, 1) (0, -1)

Show that cos(A+45)=cos45(cosA-sinA)

A bank says you can double your money in 10 years if you put $1000 in a simple interest account. What annual interest rate does the bank pay?

How is the Maunder minimum related to climate?

Theorists who emphasize the ______in explaining individual differences typically stress the importance of early experiences. A. Brain activity B. Environment C